Other Solvents
Filtered Search Results
Acetone-d{6}, 99.9% (Isotopic)
CAS: 666-52-4 Molecular Formula: C3H6O Molecular Weight (g/mol): 64.117 MDL Number: MFCD00044635 InChI Key: CSCPPACGZOOCGX-WFGJKAKNSA-N Synonym: acetone-d6,2h6 acetone,hexadeuteroacetone,acetone d6,perdeuteroacetone,deuterated acetone,unii-b0n19b53h8,cd3 2co,2-propanone-1,1,1,3,3,3-d6,d6-acetone PubChem CID: 522220 ChEBI: CHEBI:78217 IUPAC Name: 1,1,1,3,3,3-hexadeuteriopropan-2-one SMILES: CC(=O)C
| PubChem CID | 522220 |
|---|---|
| CAS | 666-52-4 |
| Molecular Weight (g/mol) | 64.117 |
| ChEBI | CHEBI:78217 |
| MDL Number | MFCD00044635 |
| SMILES | CC(=O)C |
| Synonym | acetone-d6,2h6 acetone,hexadeuteroacetone,acetone d6,perdeuteroacetone,deuterated acetone,unii-b0n19b53h8,cd3 2co,2-propanone-1,1,1,3,3,3-d6,d6-acetone |
| IUPAC Name | 1,1,1,3,3,3-hexadeuteriopropan-2-one |
| InChI Key | CSCPPACGZOOCGX-WFGJKAKNSA-N |
| Molecular Formula | C3H6O |
Deuterosulfuric acid, 96% min in D{2}O, 99.5% (Isotopic)
CAS: 13813-19-9 Molecular Formula: H2O4S Molecular Weight (g/mol): 100.08 MDL Number: MFCD00003542 InChI Key: QAOWNCQODCNURD-ZSJDYOACSA-N Synonym: sulfuric acid-d2,deuterosulfuric acid,dideuterosulfuric acid,sulphuric 2h2 acid,sulfuric acid-d2 solution,d2so4,dideuterosulfuric acid solution,2 h? sulfuric acid,sulfuric acid-d2, 98 wt% in deuterium oxide,deuterosulfuric acid min in d 2 o isotopic PubChem CID: 160992 IUPAC Name: dideuterio sulfate SMILES: [2H]OS(=O)(=O)O[2H]
| PubChem CID | 160992 |
|---|---|
| CAS | 13813-19-9 |
| Molecular Weight (g/mol) | 100.08 |
| MDL Number | MFCD00003542 |
| SMILES | [2H]OS(=O)(=O)O[2H] |
| Synonym | sulfuric acid-d2,deuterosulfuric acid,dideuterosulfuric acid,sulphuric 2h2 acid,sulfuric acid-d2 solution,d2so4,dideuterosulfuric acid solution,2 h? sulfuric acid,sulfuric acid-d2, 98 wt% in deuterium oxide,deuterosulfuric acid min in d 2 o isotopic |
| IUPAC Name | dideuterio sulfate |
| InChI Key | QAOWNCQODCNURD-ZSJDYOACSA-N |
| Molecular Formula | H2O4S |
2-Chloro-4-methylbenzeneboronic acid, 95%
CAS: 145349-62-8 Molecular Formula: C7H8BClO2 Molecular Weight (g/mol): 170.399 MDL Number: MFCD03411936 InChI Key: UKYCKUPXBPLXBA-UHFFFAOYSA-N Synonym: 2-chloro-4-methylphenyl boronic acid,2-chloro-4-methylbenzeneboronic acid,boronic acid, 2-chloro-4-methylphenyl,pubchem1778,2-chloro-4-methyl-phenyl boronic acid,acmc-209cuq,ksc524i9h,2-chloro-p-tolylboronic acid,2-chloro-4-methyl phenyl boronic acid PubChem CID: 2773334 IUPAC Name: (2-chloro-4-methylphenyl)boronic acid SMILES: B(C1=C(C=C(C=C1)C)Cl)(O)O
| PubChem CID | 2773334 |
|---|---|
| CAS | 145349-62-8 |
| Molecular Weight (g/mol) | 170.399 |
| MDL Number | MFCD03411936 |
| SMILES | B(C1=C(C=C(C=C1)C)Cl)(O)O |
| Synonym | 2-chloro-4-methylphenyl boronic acid,2-chloro-4-methylbenzeneboronic acid,boronic acid, 2-chloro-4-methylphenyl,pubchem1778,2-chloro-4-methyl-phenyl boronic acid,acmc-209cuq,ksc524i9h,2-chloro-p-tolylboronic acid,2-chloro-4-methyl phenyl boronic acid |
| IUPAC Name | (2-chloro-4-methylphenyl)boronic acid |
| InChI Key | UKYCKUPXBPLXBA-UHFFFAOYSA-N |
| Molecular Formula | C7H8BClO2 |
4-Chloro-o-phenylenediamine, 97%
CAS: 95-83-0 Molecular Formula: C6H7ClN2 Molecular Weight (g/mol): 142.59 MDL Number: MFCD00011691 InChI Key: BXIXXXYDDJVHDL-UHFFFAOYSA-N Synonym: 4-chloro-1,2-diaminobenzene,4-chloro-o-phenylenediamine,4-chloro-1,2-phenylenediamine,1,2-diamino-4-chlorobenzene,1,2-benzenediamine, 4-chloro,ursol olive 6g,3,4-diaminochlorobenzene,4-chloro-1,2-benzenediamine,2-amino-4-chloroaniline,p-chloro-o-phenylenediamine PubChem CID: 7263 ChEBI: CHEBI:82301 IUPAC Name: 4-chlorobenzene-1,2-diamine SMILES: NC1=CC=C(Cl)C=C1N
| PubChem CID | 7263 |
|---|---|
| CAS | 95-83-0 |
| Molecular Weight (g/mol) | 142.59 |
| ChEBI | CHEBI:82301 |
| MDL Number | MFCD00011691 |
| SMILES | NC1=CC=C(Cl)C=C1N |
| Synonym | 4-chloro-1,2-diaminobenzene,4-chloro-o-phenylenediamine,4-chloro-1,2-phenylenediamine,1,2-diamino-4-chlorobenzene,1,2-benzenediamine, 4-chloro,ursol olive 6g,3,4-diaminochlorobenzene,4-chloro-1,2-benzenediamine,2-amino-4-chloroaniline,p-chloro-o-phenylenediamine |
| IUPAC Name | 4-chlorobenzene-1,2-diamine |
| InChI Key | BXIXXXYDDJVHDL-UHFFFAOYSA-N |
| Molecular Formula | C6H7ClN2 |
2,5-Dimethylbenzoic acid, 98%
CAS: 610-72-0 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.18 MDL Number: MFCD00002482 InChI Key: XZRHNAFEYMSXRG-UHFFFAOYSA-N Synonym: benzoic acid, 2,5-dimethyl,isoxylic acid,2,5-dimethyl benzoic acid,unii-rke5pmk0h6,2,5-dimethyl-benzoic acid,2-carboxy-1,4-dimethylbenzene,rke5pmk0h6,p-xylene-2-carboxylic acid,2,5-dimethylbenzenecarboxylic acid,2,5-dimethylbenzoicacid PubChem CID: 11892 ChEBI: CHEBI:64825 IUPAC Name: 2,5-dimethylbenzoic acid SMILES: CC1=CC(=C(C=C1)C)C(=O)O
| PubChem CID | 11892 |
|---|---|
| CAS | 610-72-0 |
| Molecular Weight (g/mol) | 150.18 |
| ChEBI | CHEBI:64825 |
| MDL Number | MFCD00002482 |
| SMILES | CC1=CC(=C(C=C1)C)C(=O)O |
| Synonym | benzoic acid, 2,5-dimethyl,isoxylic acid,2,5-dimethyl benzoic acid,unii-rke5pmk0h6,2,5-dimethyl-benzoic acid,2-carboxy-1,4-dimethylbenzene,rke5pmk0h6,p-xylene-2-carboxylic acid,2,5-dimethylbenzenecarboxylic acid,2,5-dimethylbenzoicacid |
| IUPAC Name | 2,5-dimethylbenzoic acid |
| InChI Key | XZRHNAFEYMSXRG-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
(R)-(+)-1-(4-Chlorophenyl)ethylamine, ChiPros™ 97%, ee 98%
CAS: 27298-99-3 Molecular Formula: C8H10ClN Molecular Weight (g/mol): 155.625 MDL Number: MFCD00671639 InChI Key: PINPOEWMCLFRRB-ZCFIWIBFSA-N Synonym: r-1-4-chlorophenyl ethylamine,r-1-4-chlorophenyl ethanamine,1r-1-4-chlorophenyl ethanamine,r-+-1-4-chlorophenyl ethylamine,1r-1-4-chlorophenyl ethan-1-amine,benzenemethanamine, 4-chloro-alpha-methyl-, alphar,pubchem15222,r-4-chloro-,a-methylbenzylamine,1r-1-4-chlorophenyl ethylamine,r-1-4-chloro-phenyl ethylamine PubChem CID: 1715226 IUPAC Name: (1R)-1-(4-chlorophenyl)ethanamine SMILES: CC(C1=CC=C(C=C1)Cl)N
| PubChem CID | 1715226 |
|---|---|
| CAS | 27298-99-3 |
| Molecular Weight (g/mol) | 155.625 |
| MDL Number | MFCD00671639 |
| SMILES | CC(C1=CC=C(C=C1)Cl)N |
| Synonym | r-1-4-chlorophenyl ethylamine,r-1-4-chlorophenyl ethanamine,1r-1-4-chlorophenyl ethanamine,r-+-1-4-chlorophenyl ethylamine,1r-1-4-chlorophenyl ethan-1-amine,benzenemethanamine, 4-chloro-alpha-methyl-, alphar,pubchem15222,r-4-chloro-,a-methylbenzylamine,1r-1-4-chlorophenyl ethylamine,r-1-4-chloro-phenyl ethylamine |
| IUPAC Name | (1R)-1-(4-chlorophenyl)ethanamine |
| InChI Key | PINPOEWMCLFRRB-ZCFIWIBFSA-N |
| Molecular Formula | C8H10ClN |
1,2-Dichloroethane-d{4}, 99% (Isotopic)
CAS: 17060-07-0 Molecular Formula: C2H4Cl2 Molecular Weight (g/mol): 102.978 MDL Number: MFCD00037531 InChI Key: WSLDOOZREJYCGB-LNLMKGTHSA-N Synonym: 1,2-dichloroethane-d4,1,2-dichloroethane d4,ethylene-d4 dichloride,dichloro 2 h? ethane,1,2-dichloroethane-d4, 99 atom % d,1,2-dichloroethane-d4 98.0 atom % d,1,2-dichloroethane-d4, analytical standard,1,2-dichloroethane d4 2000 ng/microl in methanol PubChem CID: 12197860 IUPAC Name: 1,2-dichloro-1,1,2,2-tetradeuterioethane SMILES: C(CCl)Cl
| PubChem CID | 12197860 |
|---|---|
| CAS | 17060-07-0 |
| Molecular Weight (g/mol) | 102.978 |
| MDL Number | MFCD00037531 |
| SMILES | C(CCl)Cl |
| Synonym | 1,2-dichloroethane-d4,1,2-dichloroethane d4,ethylene-d4 dichloride,dichloro 2 h? ethane,1,2-dichloroethane-d4, 99 atom % d,1,2-dichloroethane-d4 98.0 atom % d,1,2-dichloroethane-d4, analytical standard,1,2-dichloroethane d4 2000 ng/microl in methanol |
| IUPAC Name | 1,2-dichloro-1,1,2,2-tetradeuterioethane |
| InChI Key | WSLDOOZREJYCGB-LNLMKGTHSA-N |
| Molecular Formula | C2H4Cl2 |
3-chloro-2-methylphenyl isothiocyanate, 97%, Thermo Scientific™
CAS: 19241-35-1 Molecular Formula: C8H6ClNS Molecular Weight (g/mol): 183.653 MDL Number: MFCD00022056 InChI Key: ZXEZATIRZLJXFU-UHFFFAOYSA-N PubChem CID: 140504 IUPAC Name: 1-chloro-3-isothiocyanato-2-methylbenzene SMILES: CC1=C(C=CC=C1Cl)N=C=S
| PubChem CID | 140504 |
|---|---|
| CAS | 19241-35-1 |
| Molecular Weight (g/mol) | 183.653 |
| MDL Number | MFCD00022056 |
| SMILES | CC1=C(C=CC=C1Cl)N=C=S |
| IUPAC Name | 1-chloro-3-isothiocyanato-2-methylbenzene |
| InChI Key | ZXEZATIRZLJXFU-UHFFFAOYSA-N |
| Molecular Formula | C8H6ClNS |
5-Bromo-2-fluoro-m-xylene, 97%
CAS: 99725-44-7 Molecular Formula: C8H8BrF Molecular Weight (g/mol): 203.054 MDL Number: MFCD01320701 InChI Key: ZXPHUVHMBKRRJF-UHFFFAOYSA-N Synonym: 5-bromo-2-fluoro-m-xylene,5-bromo-2-fluoro-3-xylene,4-bromo-2,6-dimethylfluorobenzene,1-bromo-4-fluoro-3,5-dimethylbenzene,5-bromo-2-fluoro-1,3-xylene,benzene, 5-bromo-2-fluoro-1,3-dimethyl,3,5-dimethyl-4-fluorobromobenzene,5-bromo-2-fluoro-1,3-dimethyl-benzene,ksc486i9j PubChem CID: 2736298 IUPAC Name: 5-bromo-2-fluoro-1,3-dimethylbenzene SMILES: CC1=CC(=CC(=C1F)C)Br
| PubChem CID | 2736298 |
|---|---|
| CAS | 99725-44-7 |
| Molecular Weight (g/mol) | 203.054 |
| MDL Number | MFCD01320701 |
| SMILES | CC1=CC(=CC(=C1F)C)Br |
| Synonym | 5-bromo-2-fluoro-m-xylene,5-bromo-2-fluoro-3-xylene,4-bromo-2,6-dimethylfluorobenzene,1-bromo-4-fluoro-3,5-dimethylbenzene,5-bromo-2-fluoro-1,3-xylene,benzene, 5-bromo-2-fluoro-1,3-dimethyl,3,5-dimethyl-4-fluorobromobenzene,5-bromo-2-fluoro-1,3-dimethyl-benzene,ksc486i9j |
| IUPAC Name | 5-bromo-2-fluoro-1,3-dimethylbenzene |
| InChI Key | ZXPHUVHMBKRRJF-UHFFFAOYSA-N |
| Molecular Formula | C8H8BrF |
Chlorobis(3,5-dimethylphenyl)phosphine, tech. 90%
CAS: 74289-57-9 Molecular Formula: C16H18ClP Molecular Weight (g/mol): 276.744 MDL Number: MFCD01630841 InChI Key: FCEBDAANWYNQMO-UHFFFAOYSA-N Synonym: bis 3,5-dimethylphenyl chlorophosphine,chlorobis 3,5-dimethylphenyl phosphine,chlorobis 3,5-dimethylphenyl phosphane,chloro-bis 3,5-dimethylphenyl phosphane,bis 3,5-dimethylphenyl phosphinous chloride,phosphinous chloride, bis 3,5-dimethylphenyl,bis 3,5-dimethylphenyl chlorophosphine, tech,phosphinous chloride,p,p-bis 3,5-dimethylphenyl PubChem CID: 4187520 IUPAC Name: chloro-bis(3,5-dimethylphenyl)phosphane SMILES: CC1=CC(=CC(=C1)P(C2=CC(=CC(=C2)C)C)Cl)C
| PubChem CID | 4187520 |
|---|---|
| CAS | 74289-57-9 |
| Molecular Weight (g/mol) | 276.744 |
| MDL Number | MFCD01630841 |
| SMILES | CC1=CC(=CC(=C1)P(C2=CC(=CC(=C2)C)C)Cl)C |
| Synonym | bis 3,5-dimethylphenyl chlorophosphine,chlorobis 3,5-dimethylphenyl phosphine,chlorobis 3,5-dimethylphenyl phosphane,chloro-bis 3,5-dimethylphenyl phosphane,bis 3,5-dimethylphenyl phosphinous chloride,phosphinous chloride, bis 3,5-dimethylphenyl,bis 3,5-dimethylphenyl chlorophosphine, tech,phosphinous chloride,p,p-bis 3,5-dimethylphenyl |
| IUPAC Name | chloro-bis(3,5-dimethylphenyl)phosphane |
| InChI Key | FCEBDAANWYNQMO-UHFFFAOYSA-N |
| Molecular Formula | C16H18ClP |
DL-Lactide, 99%
CAS: 95-96-5 Molecular Formula: C6H8O4 Molecular Weight (g/mol): 144.13 MDL Number: MFCD00011685,MFCD00082566 InChI Key: JJTUDXZGHPGLLC-UHFFFAOYNA-N Synonym: dl-lactide,lactide,dilactide,1,4-dioxane-2,5-dione, 3,6-dimethyl,3,6-dimethyl-2,5-dioxo-1,4-dioxane,lactic acid, bimol. cyclic ester,propanoic acid, 2-hydroxy-, bimol. cyclic ester,p-dioxane-2,5-dione, 3,6-dimethyl,d +-lactide,--l-dilactide PubChem CID: 7272 IUPAC Name: 3,6-dimethyl-1,4-dioxane-2,5-dione SMILES: CC1OC(=O)C(C)OC1=O
| PubChem CID | 7272 |
|---|---|
| CAS | 95-96-5 |
| Molecular Weight (g/mol) | 144.13 |
| MDL Number | MFCD00011685,MFCD00082566 |
| SMILES | CC1OC(=O)C(C)OC1=O |
| Synonym | dl-lactide,lactide,dilactide,1,4-dioxane-2,5-dione, 3,6-dimethyl,3,6-dimethyl-2,5-dioxo-1,4-dioxane,lactic acid, bimol. cyclic ester,propanoic acid, 2-hydroxy-, bimol. cyclic ester,p-dioxane-2,5-dione, 3,6-dimethyl,d +-lactide,--l-dilactide |
| IUPAC Name | 3,6-dimethyl-1,4-dioxane-2,5-dione |
| InChI Key | JJTUDXZGHPGLLC-UHFFFAOYNA-N |
| Molecular Formula | C6H8O4 |
Ether, Purified, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 60-29-7 Molecular Weight (g/mol): 74.12
| CAS | 60-29-7 |
|---|---|
| Molecular Weight (g/mol) | 74.12 |
2,5-Dimethylphenol, 99+%
CAS: 95-87-4 Molecular Formula: C8H10O Molecular Weight (g/mol): 122.17 MDL Number: MFCD00002237 InChI Key: NKTOLZVEWDHZMU-UHFFFAOYSA-N Synonym: 2,5-xylenol,p-xylenol,phenol, 2,5-dimethyl,3,6-dimethylphenol,6-methyl-m-cresol,3,6-xylenol,2,5-dimethyl phenol,2,5-dmp,1,2,5-xylenol,1-hydroxy-2,5-dimethylbenzene PubChem CID: 7267 IUPAC Name: 2,5-dimethylphenol SMILES: CC1=CC=C(C)C(O)=C1
| PubChem CID | 7267 |
|---|---|
| CAS | 95-87-4 |
| Molecular Weight (g/mol) | 122.17 |
| MDL Number | MFCD00002237 |
| SMILES | CC1=CC=C(C)C(O)=C1 |
| Synonym | 2,5-xylenol,p-xylenol,phenol, 2,5-dimethyl,3,6-dimethylphenol,6-methyl-m-cresol,3,6-xylenol,2,5-dimethyl phenol,2,5-dmp,1,2,5-xylenol,1-hydroxy-2,5-dimethylbenzene |
| IUPAC Name | 2,5-dimethylphenol |
| InChI Key | NKTOLZVEWDHZMU-UHFFFAOYSA-N |
| Molecular Formula | C8H10O |
n-Heptane-d{16}, 98% (Isotopic)
CAS: 33838-52-7 Molecular Formula: C7H16 Molecular Weight (g/mol): 100.21 MDL Number: MFCD00062744 InChI Key: IMNFDUFMRHMDMM-UHFFFAOYSA-N Synonym: heptane-d16,n-heptane-d 16,2h16 heptane,hexadecadeuterio-heptane,2 h?? heptane,heptane-d16, 99 atom % d PubChem CID: 524600 IUPAC Name: 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-hexadecadeuterioheptane SMILES: CCCCCCC
| PubChem CID | 524600 |
|---|---|
| CAS | 33838-52-7 |
| Molecular Weight (g/mol) | 100.21 |
| MDL Number | MFCD00062744 |
| SMILES | CCCCCCC |
| Synonym | heptane-d16,n-heptane-d 16,2h16 heptane,hexadecadeuterio-heptane,2 h?? heptane,heptane-d16, 99 atom % d |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-hexadecadeuterioheptane |
| InChI Key | IMNFDUFMRHMDMM-UHFFFAOYSA-N |
| Molecular Formula | C7H16 |